CAS 867327-33-1 is the registry number for 1-((4-Chlorophenyl)sulfonyl)-4-phenethylpiperazine, ≥97%, ≥97%. Offered by: Chemat. Available pack sizes: 5mg, 25mg, 50mg, 100mg.
1-(4-chlorophenyl)sulfonyl-4-(2-phenylethyl)piperazine (CAS 867327-33-1) is a chemical compound with the molecular formula C18H21ClN2O2S and a molecular weight of 364.9 g/mol. IUPAC name: 1-(4-chlorophenyl)sulfonyl-4-(2-phenylethyl)piperazine. InChIKey: YBRBYPLRQMSJIS-UHFFFAOYSA-N.
| Molecular formula | C18H21ClN2O2S |
|---|---|
| Molecular weight | 364.9 g/mol |
| IUPAC name | 1-(4-chlorophenyl)sulfonyl-4-(2-phenylethyl)piperazine |
| InChIKey | YBRBYPLRQMSJIS-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCC2=CC=CC=C2)S(=O)(=O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)