Products 867349-80-2
CAS 867349-80-2 is the registry number for 4,4''-Dimethoxy-[1,1':4',1''-terphenyl]-2',3'-diamine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3,6-bis(4-methoxyphenyl)benzene-1,2-diamine (CAS 867349-80-2) is a chemical compound with the molecular formula C20H20N2O2 and a molecular weight of 320.4 g/mol. IUPAC name: 3,6-bis(4-methoxyphenyl)benzene-1,2-diamine. InChIKey: RDQKROHFEGQCOC-UHFFFAOYSA-N.
| Molecular formula | C20H20N2O2 |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | 3,6-bis(4-methoxyphenyl)benzene-1,2-diamine |
| InChIKey | RDQKROHFEGQCOC-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(C(=C(C=C2)C3=CC=C(C=C3)OC)N)N |
Computed by PubChem (NCBI)