Products 60285-95-2
CAS 60285-95-2 is the registry number for H-Phe-4MbetaNA. Offered by: Creative Peptides. Available pack sizes: 250mg, 1g.
(2S)-2-amino-N-(4-methoxynaphthalen-2-yl)-3-phenylpropanamide (CAS 60285-95-2) is a chemical compound with the molecular formula C20H20N2O2 and a molecular weight of 320.4 g/mol. IUPAC name: (2S)-2-amino-N-(4-methoxynaphthalen-2-yl)-3-phenylpropanamide. InChIKey: NWIDLOZVSJGOFK-SFHVURJKSA-N.
| Molecular formula | C20H20N2O2 |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | (2S)-2-amino-N-(4-methoxynaphthalen-2-yl)-3-phenylpropanamide |
| InChIKey | NWIDLOZVSJGOFK-SFHVURJKSA-N |
| SMILES | COC1=CC(=CC2=CC=CC=C21)NC(=O)[C@H](CC3=CC=CC=C3)N |
Computed by PubChem (NCBI)