CAS 86761-38-8 appears in our catalog under these names: 2-((2-Amino-6-oxo-3,6-dihydro-9H-purin-9-yl)methoxy)-3-hydroxypropyl tetrahydrogen triphosphate, 95%, Ganciclovir triphosphate. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
[[2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-3-hydroxypropoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate (CAS 86761-38-8) is a chemical compound with the molecular formula C9H16N5O13P3 and a molecular weight of 495.17 g/mol. IUPAC name: [[2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-3-hydroxypropoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate. InChIKey: OBABDJMYPMAQEP-UHFFFAOYSA-N.
| Molecular formula | C9H16N5O13P3 |
|---|---|
| Molecular weight | 495.17 g/mol |
| IUPAC name | [[2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-3-hydroxypropoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
| InChIKey | OBABDJMYPMAQEP-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1COC(CO)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N=C(NC2=O)N |
Computed by PubChem (NCBI)