Products 868-47-3

CAS 868-47-3 is the registry number for Ethyl 2-cyano-4-methylpent-2-enoate. Offered by: Biosynth. Available pack sizes: 500mg, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 2-cyano-4-methylpent-2-enoate (CAS 868-47-3) is a chemical compound with the molecular formula C9H13NO2 and a molecular weight of 167.20 g/mol. IUPAC name: ethyl 2-cyano-4-methylpent-2-enoate. InChIKey: OTFZWJLWGXADAJ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13NO2
Molecular weight167.20 g/mol
IUPAC nameethyl 2-cyano-4-methylpent-2-enoate
InChIKeyOTFZWJLWGXADAJ-UHFFFAOYSA-N
SMILESCCOC(=O)C(=CC(C)C)C#N

Computed by PubChem (NCBI)