Products 868-68-8

CAS 868-68-8 is the registry number for Diethyl 2,6-dibromoheptanedioate, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Diethyl 2,6-dibromoheptanedioate (CAS 868-68-8) is a chemical compound with the molecular formula C11H18Br2O4 and a molecular weight of 374.07 g/mol. IUPAC name: diethyl 2,6-dibromoheptanedioate. InChIKey: SPJSPERKKWTTBF-UHFFFAOYSA-N.

Identity
Molecular formulaC11H18Br2O4
Molecular weight374.07 g/mol
IUPAC namediethyl 2,6-dibromoheptanedioate
InChIKeySPJSPERKKWTTBF-UHFFFAOYSA-N
SMILESCCOC(=O)C(CCCC(C(=O)OCC)Br)Br

Computed by PubChem (NCBI)