Products 868-73-5
CAS 868-73-5 appears in our catalog under these names: Dimethyl 2,6–dibromoheptanedioate, Dimethyl 2,6-dibromoheptanedioate, 97%, Dimethyl 2,6-dibromoheptanedioate 97 %. Offered by: GLPBio, Fluorochem, Sigma-Aldrich. Available pack sizes: 10ml, 1g, 50ML.
Dimethyl 2,6-dibromoheptanedioate (CAS 868-73-5) is a chemical compound with the molecular formula C9H14Br2O4 and a molecular weight of 346.01 g/mol. IUPAC name: dimethyl 2,6-dibromoheptanedioate. InChIKey: AWWJYEJSCIDADZ-UHFFFAOYSA-N.
| Molecular formula | C9H14Br2O4 |
|---|---|
| Molecular weight | 346.01 g/mol |
| IUPAC name | dimethyl 2,6-dibromoheptanedioate |
| InChIKey | AWWJYEJSCIDADZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CCCC(C(=O)OC)Br)Br |
Computed by PubChem (NCBI)
Synonyms:
Dimethyl 2,6-dibromoheptanedioate, 2,6-Dibromoheptanedioic acid dimethyl ester, Heptanedioic acid,2,6-dibromo-, 1,7-dimethyl ester, 2,6-Dibromopimelic acid dimethyl ester, 2,6-Dibromoheptadioic acid dimethyl ester, AWWJYEJSCIDADZ-UHFFFAOYSA-N, dimethyl 2,6-dibromoheptanedionate, DiMethyl 2,6-dibroMoheptanedioate 97%, Dimethyl 2,6-dibromoheptanedioate, 97%