CAS 868049-50-7 appears in our catalog under these names: Olodaterol Impurity 15, Olodaterol Impurity 1（(S)-Olodaterol）, (S)-Olodaterol Hydrochloride. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
6-hydroxy-8-[(1S)-1-hydroxy-2-[[1-(4-methoxyphenyl)-2-methylpropan-2-yl]amino]ethyl]-4H-1,4-benzoxazin-3-one (CAS 868049-50-7) is a chemical compound with the molecular formula C21H26N2O5 and a molecular weight of 386.4 g/mol. IUPAC name: 6-hydroxy-8-[(1S)-1-hydroxy-2-[[1-(4-methoxyphenyl)-2-methylpropan-2-yl]amino]ethyl]-4H-1,4-benzoxazin-3-one. InChIKey: COUYJEVMBVSIHV-GOSISDBHSA-N.
| Molecular formula | C21H26N2O5 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | 6-hydroxy-8-[(1S)-1-hydroxy-2-[[1-(4-methoxyphenyl)-2-methylpropan-2-yl]amino]ethyl]-4H-1,4-benzoxazin-3-one |
| InChIKey | COUYJEVMBVSIHV-GOSISDBHSA-N |
| SMILES | CC(C)(CC1=CC=C(C=C1)OC)NC[C@H](C2=C3C(=CC(=C2)O)NC(=O)CO3)O |
Computed by PubChem (NCBI)