Products 868064-73-7

CAS 868064-73-7 is the registry number for tert-Butyl 4-(3,4-difluorophenyl)-1,4-diazepane-1-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl 4-(3,4-difluorophenyl)-1,4-diazepane-1-carboxylate (CAS 868064-73-7) is a chemical compound with the molecular formula C16H22F2N2O2 and a molecular weight of 312.35 g/mol. IUPAC name: tert-butyl 4-(3,4-difluorophenyl)-1,4-diazepane-1-carboxylate. InChIKey: NTBVJKOAJJUTON-UHFFFAOYSA-N.

Identity
Molecular formulaC16H22F2N2O2
Molecular weight312.35 g/mol
IUPAC nametert-butyl 4-(3,4-difluorophenyl)-1,4-diazepane-1-carboxylate
InChIKeyNTBVJKOAJJUTON-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCN(CC1)C2=CC(=C(C=C2)F)F

Computed by PubChem (NCBI)