CAS 868071-15-2 is the registry number for Sitagliptin Impurity 80. Offered by: Chemat Brand. Available pack sizes: on request.
2,2,2-trifluoro-N'-pyrazin-2-yl-N'-(2,2,2-trifluoroacetyl)acetohydrazide (CAS 868071-15-2) is a chemical compound with the molecular formula C8H4F6N4O2 and a molecular weight of 302.13 g/mol. IUPAC name: 2,2,2-trifluoro-N'-pyrazin-2-yl-N'-(2,2,2-trifluoroacetyl)acetohydrazide. InChIKey: KAHARFOJGCYGBA-UHFFFAOYSA-N.
| Molecular formula | C8H4F6N4O2 |
|---|---|
| Molecular weight | 302.13 g/mol |
| IUPAC name | 2,2,2-trifluoro-N'-pyrazin-2-yl-N'-(2,2,2-trifluoroacetyl)acetohydrazide |
| InChIKey | KAHARFOJGCYGBA-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=N1)N(C(=O)C(F)(F)F)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)