Products 86810-96-0

CAS 86810-96-0 is the registry number for 4-((3,4-Dichlorophenyl)methoxy)piperidine hydrochloride. Offered by: Biosynth. Available pack sizes: 250mg, 100mg, 500mg, 1000mg, 2000mg.

Structural formula: {0} (CAS {1})

4-[(3,4-dichlorophenyl)methoxy]piperidine;hydrochloride (CAS 86810-96-0) is a chemical compound with the molecular formula C12H16Cl3NO and a molecular weight of 296.6 g/mol. IUPAC name: 4-[(3,4-dichlorophenyl)methoxy]piperidine;hydrochloride. InChIKey: IGVQRCAXHZFOGS-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16Cl3NO
Molecular weight296.6 g/mol
IUPAC name4-[(3,4-dichlorophenyl)methoxy]piperidine;hydrochloride
InChIKeyIGVQRCAXHZFOGS-UHFFFAOYSA-N
SMILESC1CNCCC1OCC2=CC(=C(C=C2)Cl)Cl.Cl

Computed by PubChem (NCBI)