CAS 868143-04-8 is the registry number for 6-Chloro-3-((4-fluorophenyl)methyl)-1,2,3,4-tetrahydropyrimidine-2,4-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-chloro-3-[(4-fluorophenyl)methyl]-1H-pyrimidine-2,4-dione (CAS 868143-04-8) is a chemical compound with the molecular formula C11H8ClFN2O2 and a molecular weight of 254.64 g/mol. IUPAC name: 6-chloro-3-[(4-fluorophenyl)methyl]-1H-pyrimidine-2,4-dione. InChIKey: ZLMLOZZHKPVQMF-UHFFFAOYSA-N.
| Molecular formula | C11H8ClFN2O2 |
|---|---|
| Molecular weight | 254.64 g/mol |
| IUPAC name | 6-chloro-3-[(4-fluorophenyl)methyl]-1H-pyrimidine-2,4-dione |
| InChIKey | ZLMLOZZHKPVQMF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C(=O)C=C(NC2=O)Cl)F |
Computed by PubChem (NCBI)