CAS 868269-33-4 is the registry number for (7,8-Dimethyl-2-oxo-2H-chromen-4-yl)methyl (2-fluorobenzoyl)glycinate, 95%, 95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg.
(7,8-dimethyl-2-oxochromen-4-yl)methyl 2-[(2-fluorobenzoyl)amino]acetate (CAS 868269-33-4) is a chemical compound with the molecular formula C21H18FNO5 and a molecular weight of 383.4 g/mol. IUPAC name: (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-[(2-fluorobenzoyl)amino]acetate. InChIKey: YHTQFIFMUZOZLE-UHFFFAOYSA-N.
| Molecular formula | C21H18FNO5 |
|---|---|
| Molecular weight | 383.4 g/mol |
| IUPAC name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-[(2-fluorobenzoyl)amino]acetate |
| InChIKey | YHTQFIFMUZOZLE-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C(=CC(=O)O2)COC(=O)CNC(=O)C3=CC=CC=C3F)C |
Computed by PubChem (NCBI)