Products 868269-48-1
CAS 868269-48-1 is the registry number for 2-((2,4-Dichlorobenzyl)amino)-2-oxoethyl 5-methylfuran-2-carboxylate, 98%. Offered by: Chemat. Available pack sizes: 1mg, 5mg, 25mg, 50mg, 100mg.
[2-[(2,4-dichlorophenyl)methylamino]-2-oxoethyl] 5-methylfuran-2-carboxylate (CAS 868269-48-1) is a chemical compound with the molecular formula C15H13Cl2NO4 and a molecular weight of 342.2 g/mol. IUPAC name: [2-[(2,4-dichlorophenyl)methylamino]-2-oxoethyl] 5-methylfuran-2-carboxylate. InChIKey: HXOAZXZUXBCVOH-UHFFFAOYSA-N.
| Molecular formula | C15H13Cl2NO4 |
|---|---|
| Molecular weight | 342.2 g/mol |
| IUPAC name | [2-[(2,4-dichlorophenyl)methylamino]-2-oxoethyl] 5-methylfuran-2-carboxylate |
| InChIKey | HXOAZXZUXBCVOH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(O1)C(=O)OCC(=O)NCC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)