CAS 868273-06-7 appears in our catalog under these names: Org 27569, Org 27569/ 98%, Org 27569, Org 27569, 98%, 98%, Org 27569, 99.75%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 500mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
5-chloro-3-ethyl-N-[2-(4-piperidin-1-ylphenyl)ethyl]-1H-indole-2-carboxamide (CAS 868273-06-7) is a chemical compound with the molecular formula C24H28ClN3O and a molecular weight of 409.9 g/mol. IUPAC name: 5-chloro-3-ethyl-N-[2-(4-piperidin-1-ylphenyl)ethyl]-1H-indole-2-carboxamide. InChIKey: AHFZDNYNXFMRFQ-UHFFFAOYSA-N.
| Molecular formula | C24H28ClN3O |
|---|---|
| Molecular weight | 409.9 g/mol |
| IUPAC name | 5-chloro-3-ethyl-N-[2-(4-piperidin-1-ylphenyl)ethyl]-1H-indole-2-carboxamide |
| InChIKey | AHFZDNYNXFMRFQ-UHFFFAOYSA-N |
| SMILES | CCC1=C(NC2=C1C=C(C=C2)Cl)C(=O)NCCC3=CC=C(C=C3)N4CCCCC4 |
Computed by PubChem (NCBI)