Products 868393-66-2

CAS 868393-66-2 is the registry number for Lornoxicam Impurity 33. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-hydroxy-2-methyl-1,1-dioxothieno[2,3-e]thiazine-3-carboxylic acid (CAS 868393-66-2) is a chemical compound with the molecular formula C8H7NO5S2 and a molecular weight of 261.3 g/mol. IUPAC name: 4-hydroxy-2-methyl-1,1-dioxothieno[2,3-e]thiazine-3-carboxylic acid. InChIKey: FYHROHFTOKQHJH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7NO5S2
Molecular weight261.3 g/mol
IUPAC name4-hydroxy-2-methyl-1,1-dioxothieno[2,3-e]thiazine-3-carboxylic acid
InChIKeyFYHROHFTOKQHJH-UHFFFAOYSA-N
SMILESCN1C(=C(C2=C(S1(=O)=O)C=CS2)O)C(=O)O

Computed by PubChem (NCBI)