CAS 868393-66-2 is the registry number for Lornoxicam Impurity 33. Offered by: Chemat Brand. Available pack sizes: on request.
4-hydroxy-2-methyl-1,1-dioxothieno[2,3-e]thiazine-3-carboxylic acid (CAS 868393-66-2) is a chemical compound with the molecular formula C8H7NO5S2 and a molecular weight of 261.3 g/mol. IUPAC name: 4-hydroxy-2-methyl-1,1-dioxothieno[2,3-e]thiazine-3-carboxylic acid. InChIKey: FYHROHFTOKQHJH-UHFFFAOYSA-N.
| Molecular formula | C8H7NO5S2 |
|---|---|
| Molecular weight | 261.3 g/mol |
| IUPAC name | 4-hydroxy-2-methyl-1,1-dioxothieno[2,3-e]thiazine-3-carboxylic acid |
| InChIKey | FYHROHFTOKQHJH-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C2=C(S1(=O)=O)C=CS2)O)C(=O)O |
Computed by PubChem (NCBI)