CAS 868592-56-7 appears in our catalog under these names: NIAD 4, NIAD-4, 95+%, NIAD-4, NIAD–4, 2-((5'-(4-Hydroxyphenyl)-[2,2'-bithiophen]-5-yl)methylene)malononitrile, 95%, 95%. Offered by: TRC, AmBeed, TargetMol, GLPBio, Chemat. Available pack sizes: 1g, 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 5 mg.
2-[[5-[5-(4-hydroxyphenyl)thiophen-2-yl]thiophen-2-yl]methylidene]propanedinitrile (CAS 868592-56-7) is a chemical compound with the molecular formula C18H10N2OS2 and a molecular weight of 334.4 g/mol. IUPAC name: 2-[[5-[5-(4-hydroxyphenyl)thiophen-2-yl]thiophen-2-yl]methylidene]propanedinitrile. InChIKey: KLFRZDOQQDHVSS-UHFFFAOYSA-N.
| Molecular formula | C18H10N2OS2 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | 2-[[5-[5-(4-hydroxyphenyl)thiophen-2-yl]thiophen-2-yl]methylidene]propanedinitrile |
| InChIKey | KLFRZDOQQDHVSS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(S2)C3=CC=C(S3)C=C(C#N)C#N)O |
Computed by PubChem (NCBI)