Products 86866-14-0
CAS 86866-14-0 is the registry number for 3,4-Dichlorobenzoic anhydride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(3,4-dichlorobenzoyl) 3,4-dichlorobenzoate (CAS 86866-14-0) is a chemical compound with the molecular formula C14H6Cl4O3 and a molecular weight of 364.0 g/mol. IUPAC name: (3,4-dichlorobenzoyl) 3,4-dichlorobenzoate. InChIKey: JKRVKAAJSJWYFT-UHFFFAOYSA-N.
| Molecular formula | C14H6Cl4O3 |
|---|---|
| Molecular weight | 364.0 g/mol |
| IUPAC name | (3,4-dichlorobenzoyl) 3,4-dichlorobenzoate |
| InChIKey | JKRVKAAJSJWYFT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)OC(=O)C2=CC(=C(C=C2)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)