CAS 868698-49-1 appears in our catalog under these names: (R)-(-)-α-Methylhistamine dihydrobromide, (R)–(–)–α–Methylhistamine dihydrobromide, (αR)-α-Methyl-1H-imidazole-5-ethanamine Hydrobromide, (R)-(-)-α-Methylhistamine (dihydrobromide), 98.0%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 50mg, 10mg, 1mg, 5mg, 25mg, 100mg, 10 mg, 25 mg.
(2R)-1-(1H-imidazol-5-yl)propan-2-amine;dihydrobromide (CAS 868698-49-1) is a chemical compound with the molecular formula C6H13Br2N3 and a molecular weight of 287.00 g/mol. IUPAC name: (2R)-1-(1H-imidazol-5-yl)propan-2-amine;dihydrobromide. InChIKey: RWHNAAABSGVRDT-ZJIMSODOSA-N.
| Molecular formula | C6H13Br2N3 |
|---|---|
| Molecular weight | 287.00 g/mol |
| IUPAC name | (2R)-1-(1H-imidazol-5-yl)propan-2-amine;dihydrobromide |
| InChIKey | RWHNAAABSGVRDT-ZJIMSODOSA-N |
| SMILES | C[C@H](CC1=CN=CN1)N.Br.Br |
Computed by PubChem (NCBI)