CAS 868847-75-0 appears in our catalog under these names: 1,4–Dibromo–2,5–divinylbenzene, 1,4-dibromo-2,5-divinylbenzene, 98%, 98%, 1,4-Dibromo-2,5-divinylbenzene, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 500mg, 1g, 250mg.
1,4-dibromo-2,5-bis(ethenyl)benzene (CAS 868847-75-0) is a chemical compound with the molecular formula C10H8Br2 and a molecular weight of 287.98 g/mol. IUPAC name: 1,4-dibromo-2,5-bis(ethenyl)benzene. InChIKey: GGOANPPGLZIFIV-UHFFFAOYSA-N.
| Molecular formula | C10H8Br2 |
|---|---|
| Molecular weight | 287.98 g/mol |
| IUPAC name | 1,4-dibromo-2,5-bis(ethenyl)benzene |
| InChIKey | GGOANPPGLZIFIV-UHFFFAOYSA-N |
| SMILES | C=CC1=CC(=C(C=C1Br)C=C)Br |
Computed by PubChem (NCBI)