Products 869-09-0
CAS 869-09-0 appears in our catalog under these names: 2,4-Dibromo-pentanedioic acid dimethyl ester, 95%, Dimethyl 2，4–dibromopentanedioate, Dimethyl 2,4-dibromoglutarate, Dimethyl 2,4-dibromopentanedioate 95%, Pentanedioic acid, 2,4-dibromo-, dimethyl ester, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 10g, 1g, 5g, 250mg, 50g, 25g, 100g.
Dimethyl 2,4-dibromopentanedioate (CAS 869-09-0) is a chemical compound with the molecular formula C7H10Br2O4 and a molecular weight of 317.96 g/mol. IUPAC name: dimethyl 2,4-dibromopentanedioate. InChIKey: ZBBXTTCCOXKVJB-UHFFFAOYSA-N.
| Molecular formula | C7H10Br2O4 |
|---|---|
| Molecular weight | 317.96 g/mol |
| IUPAC name | dimethyl 2,4-dibromopentanedioate |
| InChIKey | ZBBXTTCCOXKVJB-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CC(C(=O)OC)Br)Br |
Computed by PubChem (NCBI)
Synonyms:
Dimethyl 2,4-dibromopentanedioate, Pentanedioic acid, 2,4-dibromo-, dimethyl ester, 2,4-Dibromoglutaric acid dimethyl ester, Dimethyl2,4-dibromopentanedioate, 2,4-Dibromopentanedioic acid 1,5-dimethyl ester, Pentanedioic acid, 2,4-dibromo-, 1,5-dimethyl ester, 2,4-Dibromo-Pentanedioic Acid Dimethyl Ester(WX630083)