CAS 869085-70-1 is the registry number for 1-(2,6-Diisopropylphenyl)-2,2,4,4-tetramethyl-5l2-pyrrolidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[2,6-di(propan-2-yl)phenyl]-3,3,5,5-tetramethyl-2,4-dihydropyrrol-1-ium-2-ide (CAS 869085-70-1) is a chemical compound with the molecular formula C20H31N and a molecular weight of 285.5 g/mol. IUPAC name: 1-[2,6-di(propan-2-yl)phenyl]-3,3,5,5-tetramethyl-2,4-dihydropyrrol-1-ium-2-ide. InChIKey: BRSFBXRWEIXYIF-UHFFFAOYSA-N.
| Molecular formula | C20H31N |
|---|---|
| Molecular weight | 285.5 g/mol |
| IUPAC name | 1-[2,6-di(propan-2-yl)phenyl]-3,3,5,5-tetramethyl-2,4-dihydropyrrol-1-ium-2-ide |
| InChIKey | BRSFBXRWEIXYIF-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC=C1)C(C)C)[N+]2=[C-]C(CC2(C)C)(C)C |
Computed by PubChem (NCBI)