CAS 869085-97-2 appears in our catalog under these names: 2,2-Difluoro-5-isothiocyanato-2H-1,3-benzodioxole, 95%, 2,2-Difluoro-5-isothiocyanato-1,3-dioxaindane. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2,2-difluoro-5-isothiocyanato-1,3-benzodioxole (CAS 869085-97-2) is a chemical compound with the molecular formula C8H3F2NO2S and a molecular weight of 215.18 g/mol. IUPAC name: 2,2-difluoro-5-isothiocyanato-1,3-benzodioxole. InChIKey: PKCOTODGEAJGQZ-UHFFFAOYSA-N.
| Molecular formula | C8H3F2NO2S |
|---|---|
| Molecular weight | 215.18 g/mol |
| IUPAC name | 2,2-difluoro-5-isothiocyanato-1,3-benzodioxole |
| InChIKey | PKCOTODGEAJGQZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N=C=S)OC(O2)(F)F |
Computed by PubChem (NCBI)