CAS 869112-31-2 appears in our catalog under these names: Umeclidinium Bromide Impurity 3 Bromide, Umeclidinium bromide Impurity 3, 4-(Hydroxydiphenylmethyl)-1-(2-hydroxyethyl)quinuclidin-1-ium bromide, 95%. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[4-[hydroxy(diphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]ethanol bromide (CAS 869112-31-2) is a chemical compound with the molecular formula C22H28BrNO2 and a molecular weight of 418.4 g/mol. IUPAC name: 2-[4-[hydroxy(diphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]ethanol bromide. InChIKey: ISRCFEMWSXVREU-UHFFFAOYSA-M.
| Molecular formula | C22H28BrNO2 |
|---|---|
| Molecular weight | 418.4 g/mol |
| IUPAC name | 2-[4-[hydroxy(diphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]ethanol bromide |
| InChIKey | ISRCFEMWSXVREU-UHFFFAOYSA-M |
| SMILES | C1C[N+]2(CCC1(CC2)C(C3=CC=CC=C3)(C4=CC=CC=C4)O)CCO.[Br-] |
Computed by PubChem (NCBI)