CAS 869113-10-0 appears in our catalog under these names: 1-Benzyl-4-(hydroxydiphenylmethyl)quinuclidin-1-ium bromide, 98%, Umeclidinium Bromide Impurity 11, Umeclidinium Bromide Impurity 9. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(1-benzyl-1-azoniabicyclo[2.2.2]octan-4-yl)-diphenylmethanol bromide (CAS 869113-10-0) is a chemical compound with the molecular formula C27H30BrNO and a molecular weight of 464.4 g/mol. IUPAC name: (1-benzyl-1-azoniabicyclo[2.2.2]octan-4-yl)-diphenylmethanol bromide. InChIKey: YOFHBDQMAPWLGH-UHFFFAOYSA-M.
| Molecular formula | C27H30BrNO |
|---|---|
| Molecular weight | 464.4 g/mol |
| IUPAC name | (1-benzyl-1-azoniabicyclo[2.2.2]octan-4-yl)-diphenylmethanol bromide |
| InChIKey | YOFHBDQMAPWLGH-UHFFFAOYSA-M |
| SMILES | C1C[N+]2(CCC1(CC2)C(C3=CC=CC=C3)(C4=CC=CC=C4)O)CC5=CC=CC=C5.[Br-] |
Computed by PubChem (NCBI)