CAS 869113-45-1 appears in our catalog under these names: Umeclidinium bromide Impurity 2, Umeclidinium Bromide Impurity 4 Bromide. Offered by: Chemat Brand. Available pack sizes: on request.
2-[4-[hydroxy(diphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]ethyl benzoate bromide (CAS 869113-45-1) is a chemical compound with the molecular formula C29H32BrNO3 and a molecular weight of 522.5 g/mol. IUPAC name: 2-[4-[hydroxy(diphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]ethyl benzoate bromide. InChIKey: UYHCLLDIQQNVPF-UHFFFAOYSA-M.
| Molecular formula | C29H32BrNO3 |
|---|---|
| Molecular weight | 522.5 g/mol |
| IUPAC name | 2-[4-[hydroxy(diphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]ethyl benzoate bromide |
| InChIKey | UYHCLLDIQQNVPF-UHFFFAOYSA-M |
| SMILES | C1C[N+]2(CCC1(CC2)C(C3=CC=CC=C3)(C4=CC=CC=C4)O)CCOC(=O)C5=CC=CC=C5.[Br-] |
Computed by PubChem (NCBI)