CAS 869185-55-7 is the registry number for Umeclidinium Bromide Impurity 4. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
2-[4-[hydroxy(diphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]ethyl benzoate (CAS 869185-55-7) is a chemical compound with the molecular formula C29H32NO3+ and a molecular weight of 442.6 g/mol. IUPAC name: 2-[4-[hydroxy(diphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]ethyl benzoate. InChIKey: ATWPCGOFKPYSOG-UHFFFAOYSA-N.
| Molecular formula | C29H32NO3+ |
|---|---|
| Molecular weight | 442.6 g/mol |
| IUPAC name | 2-[4-[hydroxy(diphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]ethyl benzoate |
| InChIKey | ATWPCGOFKPYSOG-UHFFFAOYSA-N |
| SMILES | C1C[N+]2(CCC1(CC2)C(C3=CC=CC=C3)(C4=CC=CC=C4)O)CCOC(=O)C5=CC=CC=C5 |
Computed by PubChem (NCBI)