Products 869304-55-2
CAS 869304-55-2 appears in our catalog under these names: Eg5 Inhibitor V, trans-24/ 97.45% (existing batch purity), Eg5 Inhibitor V, trans-24, ≥98%, ≥98%, Eg5 Inhibitor V, trans-24, 98.18%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10 mg.
(10R,15S)-13-benzyl-10-(3-hydroxyphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione (CAS 869304-55-2) is a chemical compound with the molecular formula C26H21N3O3 and a molecular weight of 423.5 g/mol. IUPAC name: (10R,15S)-13-benzyl-10-(3-hydroxyphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione. InChIKey: UOKINRKWPYVMSZ-LADGPHEKSA-N.
| Molecular formula | C26H21N3O3 |
|---|---|
| Molecular weight | 423.5 g/mol |
| IUPAC name | (10R,15S)-13-benzyl-10-(3-hydroxyphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione |
| InChIKey | UOKINRKWPYVMSZ-LADGPHEKSA-N |
| SMILES | C1[C@H]2C(=O)N(C(=O)N2[C@@H](C3=C1C4=CC=CC=C4N3)C5=CC(=CC=C5)O)CC6=CC=CC=C6 |
Computed by PubChem (NCBI)