Products 86938-64-9
CAS 86938-64-9 appears in our catalog under these names: 4,5-DIBROMOPHTHALONITRILE, ≥98%, 4,5-Dibromo-1,2-benzenedicarbonitrile, ≥98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 5g.
4,5-dibromobenzene-1,2-dicarbonitrile (CAS 86938-64-9) is a chemical compound with the molecular formula C8H2Br2N2 and a molecular weight of 285.92 g/mol. IUPAC name: 4,5-dibromobenzene-1,2-dicarbonitrile. InChIKey: GWFFZICBNFSEIX-UHFFFAOYSA-N.
| Molecular formula | C8H2Br2N2 |
|---|---|
| Molecular weight | 285.92 g/mol |
| IUPAC name | 4,5-dibromobenzene-1,2-dicarbonitrile |
| InChIKey | GWFFZICBNFSEIX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)Br)C#N)C#N |
Computed by PubChem (NCBI)