CAS 869464-86-8 appears in our catalog under these names: (6-Nitro-3-oxo-2,3-dihydro-4h-1,4-benzoxazin-4-yl)acetic acid, 95%, 2-(6-Nitro-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-4-yl)acetic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetic acid (CAS 869464-86-8) is a chemical compound with the molecular formula C10H8N2O6 and a molecular weight of 252.18 g/mol. IUPAC name: 2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetic acid. InChIKey: BKZJXMCGQRZVLP-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O6 |
|---|---|
| Molecular weight | 252.18 g/mol |
| IUPAC name | 2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetic acid |
| InChIKey | BKZJXMCGQRZVLP-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C2=C(O1)C=CC(=C2)[N+](=O)[O-])CC(=O)O |
Computed by PubChem (NCBI)