CAS 869481-92-5 appears in our catalog under these names: Trans-3,4-difluoropyrrolidine hydrochloride, 95%, trans-3,4-Difluoropyrrolidine hydrochloride 98%, trans-3,4-Difluoropyrrolidine Hydrochloride, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
(3R,4R)-3,4-difluoropyrrolidine;hydrochloride (CAS 869481-92-5) is a chemical compound with the molecular formula C4H8ClF2N and a molecular weight of 143.56 g/mol. IUPAC name: (3R,4R)-3,4-difluoropyrrolidine;hydrochloride. InChIKey: JDUYOMPVOXGHIR-VKKIDBQXSA-N.
| Molecular formula | C4H8ClF2N |
|---|---|
| Molecular weight | 143.56 g/mol |
| IUPAC name | (3R,4R)-3,4-difluoropyrrolidine;hydrochloride |
| InChIKey | JDUYOMPVOXGHIR-VKKIDBQXSA-N |
| SMILES | C1[C@H]([C@@H](CN1)F)F.Cl |
Computed by PubChem (NCBI)