Products 869499-38-7
CAS 869499-38-7 is the registry number for GSK345931A. Offered by: MedChemExpress. Available pack sizes: Get quote.
Sodium 6-[2-[5-chloro-2-(2-methylpropoxy)phenyl]phenyl]pyridine-2-carboxylate (CAS 869499-38-7) is a chemical compound with the molecular formula C22H19ClNNaO3 and a molecular weight of 403.8 g/mol. IUPAC name: sodium 6-[2-[5-chloro-2-(2-methylpropoxy)phenyl]phenyl]pyridine-2-carboxylate. InChIKey: HCPQFFJXXAUWBN-UHFFFAOYSA-M.
| Molecular formula | C22H19ClNNaO3 |
|---|---|
| Molecular weight | 403.8 g/mol |
| IUPAC name | sodium 6-[2-[5-chloro-2-(2-methylpropoxy)phenyl]phenyl]pyridine-2-carboxylate |
| InChIKey | HCPQFFJXXAUWBN-UHFFFAOYSA-M |
| SMILES | CC(C)COC1=C(C=C(C=C1)Cl)C2=CC=CC=C2C3=NC(=CC=C3)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)