Products 86958-53-4

CAS 86958-53-4 is the registry number for (1-Methyl-2-((tetrahydro-2H-pyran-2-yl)oxy)ethylidene)-propanedioic Acid Diethyl Ester. Offered by: TRC. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Diethyl 2-[1-(oxan-2-yloxy)propan-2-ylidene]propanedioate (CAS 86958-53-4) is a chemical compound with the molecular formula C15H24O6 and a molecular weight of 300.35 g/mol. IUPAC name: diethyl 2-[1-(oxan-2-yloxy)propan-2-ylidene]propanedioate. InChIKey: LESSPILOSKJBKI-UHFFFAOYSA-N.

Identity
Molecular formulaC15H24O6
Molecular weight300.35 g/mol
IUPAC namediethyl 2-[1-(oxan-2-yloxy)propan-2-ylidene]propanedioate
InChIKeyLESSPILOSKJBKI-UHFFFAOYSA-N
SMILESCCOC(=O)C(=C(C)COC1CCCCO1)C(=O)OCC

Computed by PubChem (NCBI)