Products 869631-30-1
CAS 869631-30-1 is the registry number for 2-Acetamino-4'-tert-butylbiphenyl, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
N-[2-(4-tert-butylphenyl)phenyl]acetamide (CAS 869631-30-1) is a chemical compound with the molecular formula C18H21NO and a molecular weight of 267.4 g/mol. IUPAC name: N-[2-(4-tert-butylphenyl)phenyl]acetamide. InChIKey: ROICZPMKCFCEEL-UHFFFAOYSA-N.
| Molecular formula | C18H21NO |
|---|---|
| Molecular weight | 267.4 g/mol |
| IUPAC name | N-[2-(4-tert-butylphenyl)phenyl]acetamide |
| InChIKey | ROICZPMKCFCEEL-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=CC=C1C2=CC=C(C=C2)C(C)(C)C |
Computed by PubChem (NCBI)