Products 869631-30-1

CAS 869631-30-1 is the registry number for 2-Acetamino-4'-tert-butylbiphenyl, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

N-[2-(4-tert-butylphenyl)phenyl]acetamide (CAS 869631-30-1) is a chemical compound with the molecular formula C18H21NO and a molecular weight of 267.4 g/mol. IUPAC name: N-[2-(4-tert-butylphenyl)phenyl]acetamide. InChIKey: ROICZPMKCFCEEL-UHFFFAOYSA-N.

Identity
Molecular formulaC18H21NO
Molecular weight267.4 g/mol
IUPAC nameN-[2-(4-tert-butylphenyl)phenyl]acetamide
InChIKeyROICZPMKCFCEEL-UHFFFAOYSA-N
SMILESCC(=O)NC1=CC=CC=C1C2=CC=C(C=C2)C(C)(C)C

Computed by PubChem (NCBI)