Products 869714-27-2
CAS 869714-27-2 is the registry number for 3-((3,4-Dichlorophenyl)sulfonamido)-N-(4-methoxybenzyl)benzamide, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
3-[(3,4-dichlorophenyl)sulfonylamino]-N-[(4-methoxyphenyl)methyl]benzamide (CAS 869714-27-2) is a chemical compound with the molecular formula C21H18Cl2N2O4S and a molecular weight of 465.3 g/mol. IUPAC name: 3-[(3,4-dichlorophenyl)sulfonylamino]-N-[(4-methoxyphenyl)methyl]benzamide. InChIKey: BXZXMHHNACEBGC-UHFFFAOYSA-N.
| Molecular formula | C21H18Cl2N2O4S |
|---|---|
| Molecular weight | 465.3 g/mol |
| IUPAC name | 3-[(3,4-dichlorophenyl)sulfonylamino]-N-[(4-methoxyphenyl)methyl]benzamide |
| InChIKey | BXZXMHHNACEBGC-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CNC(=O)C2=CC(=CC=C2)NS(=O)(=O)C3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)