Products 869942-41-6

CAS 869942-41-6 is the registry number for 2-((1-Methyl-1H-1,2,3,4-tetrazol-5-yl)sulfanyl)propanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-(1-methyltetrazol-5-yl)sulfanylpropanoic acid (CAS 869942-41-6) is a chemical compound with the molecular formula C5H8N4O2S and a molecular weight of 188.21 g/mol. IUPAC name: 2-(1-methyltetrazol-5-yl)sulfanylpropanoic acid. InChIKey: KZFCUJBAOQBABS-UHFFFAOYSA-N.

Identity
Molecular formulaC5H8N4O2S
Molecular weight188.21 g/mol
IUPAC name2-(1-methyltetrazol-5-yl)sulfanylpropanoic acid
InChIKeyKZFCUJBAOQBABS-UHFFFAOYSA-N
SMILESCC(C(=O)O)SC1=NN=NN1C

Computed by PubChem (NCBI)