CAS 869947-09-1 is the registry number for 2,3,5,6-Tetramethylbenzenesulfonohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
2,3,5,6-tetramethylbenzenesulfonohydrazide (CAS 869947-09-1) is a chemical compound with the molecular formula C10H16N2O2S and a molecular weight of 228.31 g/mol. IUPAC name: 2,3,5,6-tetramethylbenzenesulfonohydrazide. InChIKey: GFXMTBMOSXPILB-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O2S |
|---|---|
| Molecular weight | 228.31 g/mol |
| IUPAC name | 2,3,5,6-tetramethylbenzenesulfonohydrazide |
| InChIKey | GFXMTBMOSXPILB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C)S(=O)(=O)NN)C)C |
Computed by PubChem (NCBI)