CAS 869952-75-0 is the registry number for 4-((2,4-Difluorophenoxy)methyl)thiophene-2-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(2,4-difluorophenoxy)methyl]thiophene-2-carbaldehyde (CAS 869952-75-0) is a chemical compound with the molecular formula C12H8F2O2S and a molecular weight of 254.25 g/mol. IUPAC name: 4-[(2,4-difluorophenoxy)methyl]thiophene-2-carbaldehyde. InChIKey: DXCOEYSKJZAEQH-UHFFFAOYSA-N.
| Molecular formula | C12H8F2O2S |
|---|---|
| Molecular weight | 254.25 g/mol |
| IUPAC name | 4-[(2,4-difluorophenoxy)methyl]thiophene-2-carbaldehyde |
| InChIKey | DXCOEYSKJZAEQH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)OCC2=CSC(=C2)C=O |
Computed by PubChem (NCBI)