CAS 869967-21-5 is the registry number for 4-methyl-1-trityl-imidazole-2-carbaldehyde, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
4-methyl-1-tritylimidazole-2-carbaldehyde (CAS 869967-21-5) is a chemical compound with the molecular formula C24H20N2O and a molecular weight of 352.4 g/mol. IUPAC name: 4-methyl-1-tritylimidazole-2-carbaldehyde. InChIKey: COEIUYIKZISWBD-UHFFFAOYSA-N.
| Molecular formula | C24H20N2O |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | 4-methyl-1-tritylimidazole-2-carbaldehyde |
| InChIKey | COEIUYIKZISWBD-UHFFFAOYSA-N |
| SMILES | CC1=CN(C(=N1)C=O)C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)