CAS 87-45-6 is the registry number for Pentione. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 100mg, 50mg.
4-(2-methyl-5-prop-1-en-2-ylcyclopenten-1-yl)butan-2-one (CAS 87-45-6) is a chemical compound with the molecular formula C13H20O and a molecular weight of 192.30 g/mol. IUPAC name: 4-(2-methyl-5-prop-1-en-2-ylcyclopenten-1-yl)butan-2-one. InChIKey: DMGPXLFAXQJGKK-UHFFFAOYSA-N.
| Molecular formula | C13H20O |
|---|---|
| Molecular weight | 192.30 g/mol |
| IUPAC name | 4-(2-methyl-5-prop-1-en-2-ylcyclopenten-1-yl)butan-2-one |
| InChIKey | DMGPXLFAXQJGKK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(CC1)C(=C)C)CCC(=O)C |
Computed by PubChem (NCBI)