CAS 87-82-1 appears in our catalog under these names: Hexabromobenzene, Hexabromobenzene, 97% , Hexabromobenzene, >99.0%(GC), Hexabromobenzene 99%, HEXABROMOBENZENE, 98%. Offered by: TRC, Dr. Ehrenstorfer, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 25g, 50g, 5g, 250mg, 100g, 500g, 1000g, 1kg.
1,2,3,4,5,6-hexabromobenzene (CAS 87-82-1) is a chemical compound with the molecular formula C6Br6 and a molecular weight of 551.5 g/mol. IUPAC name: 1,2,3,4,5,6-hexabromobenzene. InChIKey: CAYGQBVSOZLICD-UHFFFAOYSA-N.
| Molecular formula | C6Br6 |
|---|---|
| Molecular weight | 551.5 g/mol |
| IUPAC name | 1,2,3,4,5,6-hexabromobenzene |
| InChIKey | CAYGQBVSOZLICD-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1Br)Br)Br)Br)Br)Br |
Computed by PubChem (NCBI)