CAS 870010-07-4 appears in our catalog under these names: Fmoc-L-Ala(5-Thiazolyl)-OH 98%, Fmoc-3-Ala(5-thiazoyl)-OH, 98%, 98%, Fmoc-3-Ala(5-thiazoyl)-OH, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1,3-thiazol-5-yl)propanoic acid (CAS 870010-07-4) is a chemical compound with the molecular formula C21H18N2O4S and a molecular weight of 394.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1,3-thiazol-5-yl)propanoic acid. InChIKey: FSZBNXUXDFKAHT-IBGZPJMESA-N.
| Molecular formula | C21H18N2O4S |
|---|---|
| Molecular weight | 394.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1,3-thiazol-5-yl)propanoic acid |
| InChIKey | FSZBNXUXDFKAHT-IBGZPJMESA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CN=CS4)C(=O)O |
Computed by PubChem (NCBI)