CAS 870221-30-0 is the registry number for 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[2-(4-nitrophenoxy)phenyl]-, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4,4,5,5-tetramethyl-2-[2-(4-nitrophenoxy)phenyl]-1,3,2-dioxaborolane (CAS 870221-30-0) is a chemical compound with the molecular formula C18H20BNO5 and a molecular weight of 341.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[2-(4-nitrophenoxy)phenyl]-1,3,2-dioxaborolane. InChIKey: IGOIUMIRXNPEIE-UHFFFAOYSA-N.
| Molecular formula | C18H20BNO5 |
|---|---|
| Molecular weight | 341.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[2-(4-nitrophenoxy)phenyl]-1,3,2-dioxaborolane |
| InChIKey | IGOIUMIRXNPEIE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2OC3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)