CAS 870244-35-2 appears in our catalog under these names: 4-Bromo-1h-pyrazolo[3,4-c]pyridin-3-amine, 95%, 4-Bromo-2h-pyrazolo[3,4-c]pyridin-3-ylamine, 95%, 4-Bromo-1H-pyrazolo(3,4-c)pyridin-3-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 250mg, 2,5g.
4-bromo-1H-pyrazolo[3,4-c]pyridin-3-amine (CAS 870244-35-2) is a chemical compound with the molecular formula C6H5BrN4 and a molecular weight of 213.03 g/mol. IUPAC name: 4-bromo-1H-pyrazolo[3,4-c]pyridin-3-amine. InChIKey: VYPIFWSZDOHBOG-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN4 |
|---|---|
| Molecular weight | 213.03 g/mol |
| IUPAC name | 4-bromo-1H-pyrazolo[3,4-c]pyridin-3-amine |
| InChIKey | VYPIFWSZDOHBOG-UHFFFAOYSA-N |
| SMILES | C1=C2C(=C(C=N1)Br)C(=NN2)N |
Computed by PubChem (NCBI)