CAS 870259-02-2 appears in our catalog under these names: 1,3,6,8–Tetraethynylpyrene, 1,3,6,8-Tetraethynylpyrene 95%, 1,3,6,8-Tetraethynylpyrene, 97%, 97%, 1,3,6,8-Tetraethynylpyrene, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 10g, 100mg, 5g.
1,3,6,8-tetraethynylpyrene (CAS 870259-02-2) is a chemical compound with the molecular formula C24H10 and a molecular weight of 298.3 g/mol. IUPAC name: 1,3,6,8-tetraethynylpyrene. InChIKey: KSGRPWUUBFXSMB-UHFFFAOYSA-N.
| Molecular formula | C24H10 |
|---|---|
| Molecular weight | 298.3 g/mol |
| IUPAC name | 1,3,6,8-tetraethynylpyrene |
| InChIKey | KSGRPWUUBFXSMB-UHFFFAOYSA-N |
| SMILES | C#CC1=CC(=C2C=CC3=C(C=C(C4=C3C2=C1C=C4)C#C)C#C)C#C |
Computed by PubChem (NCBI)