CAS 87027-39-2 appears in our catalog under these names: 4-Bromo-2-methylbutan-2-yl oxazole-4-carboxylate, 97%, tert-Butyl 2-(bromomethyl)-1,3-oxazole-4-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Tert-butyl 2-(bromomethyl)-1,3-oxazole-4-carboxylate (CAS 87027-39-2) is a chemical compound with the molecular formula C9H12BrNO3 and a molecular weight of 262.10 g/mol. IUPAC name: tert-butyl 2-(bromomethyl)-1,3-oxazole-4-carboxylate. InChIKey: OVULLLZBCDDFSV-UHFFFAOYSA-N.
| Molecular formula | C9H12BrNO3 |
|---|---|
| Molecular weight | 262.10 g/mol |
| IUPAC name | tert-butyl 2-(bromomethyl)-1,3-oxazole-4-carboxylate |
| InChIKey | OVULLLZBCDDFSV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=COC(=N1)CBr |
Computed by PubChem (NCBI)