CAS 870296-13-2 is the registry number for 1-Hexyl-4-methylpyridin-1-ium bis((trifluoromethyl)sulfonyl)amide, 95%. Offered by: Ambeed. Available pack sizes: 25g, 100g.
Bis(trifluoromethylsulfonyl)azanide;1-hexyl-4-methylpyridin-1-ium (CAS 870296-13-2) is a chemical compound with the molecular formula C14H20F6N2O4S2 and a molecular weight of 458.4 g/mol. IUPAC name: bis(trifluoromethylsulfonyl)azanide;1-hexyl-4-methylpyridin-1-ium. InChIKey: CGNMFVSTZLKCNN-UHFFFAOYSA-N.
| Molecular formula | C14H20F6N2O4S2 |
|---|---|
| Molecular weight | 458.4 g/mol |
| IUPAC name | bis(trifluoromethylsulfonyl)azanide;1-hexyl-4-methylpyridin-1-ium |
| InChIKey | CGNMFVSTZLKCNN-UHFFFAOYSA-N |
| SMILES | CCCCCC[N+]1=CC=C(C=C1)C.C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)