CAS 87032-92-6 is the registry number for Cilostazol Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.
Sodium 2-oxo-3,4-dihydro-1H-quinolin-6-olate (CAS 87032-92-6) is a chemical compound with the molecular formula C9H8NNaO2 and a molecular weight of 185.15 g/mol. IUPAC name: sodium 2-oxo-3,4-dihydro-1H-quinolin-6-olate. InChIKey: RWRMRZTVZFQLRR-UHFFFAOYSA-M.
| Molecular formula | C9H8NNaO2 |
|---|---|
| Molecular weight | 185.15 g/mol |
| IUPAC name | sodium 2-oxo-3,4-dihydro-1H-quinolin-6-olate |
| InChIKey | RWRMRZTVZFQLRR-UHFFFAOYSA-M |
| SMILES | C1CC(=O)NC2=C1C=C(C=C2)[O-].[Na+] |
Computed by PubChem (NCBI)