CAS 870484-38-1 is the registry number for N,N-Dimethyl-4-(triethylsilyl)benzenamine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
N,N-dimethyl-4-triethylsilylaniline (CAS 870484-38-1) is a chemical compound with the molecular formula C14H25NSi and a molecular weight of 235.44 g/mol. IUPAC name: N,N-dimethyl-4-triethylsilylaniline. InChIKey: HAZGYNJFZJEYIS-UHFFFAOYSA-N.
| Molecular formula | C14H25NSi |
|---|---|
| Molecular weight | 235.44 g/mol |
| IUPAC name | N,N-dimethyl-4-triethylsilylaniline |
| InChIKey | HAZGYNJFZJEYIS-UHFFFAOYSA-N |
| SMILES | CC[Si](CC)(CC)C1=CC=C(C=C1)N(C)C |
Computed by PubChem (NCBI)