Products 870562-26-8
CAS 870562-26-8 is the registry number for (4-Fluoronaphthalen-1-yl)methanamine hydrochloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
(4-fluoronaphthalen-1-yl)methanamine;hydrochloride (CAS 870562-26-8) is a chemical compound with the molecular formula C11H11ClFN and a molecular weight of 211.66 g/mol. IUPAC name: (4-fluoronaphthalen-1-yl)methanamine;hydrochloride. InChIKey: VJKUTCCLWGVVDY-UHFFFAOYSA-N.
| Molecular formula | C11H11ClFN |
|---|---|
| Molecular weight | 211.66 g/mol |
| IUPAC name | (4-fluoronaphthalen-1-yl)methanamine;hydrochloride |
| InChIKey | VJKUTCCLWGVVDY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2F)CN.Cl |
Computed by PubChem (NCBI)